C16H15NO2 — CID 116555381
2-anilino-1-(2,3-dihydro-1-benzofuran-5-yl)ethanone (PubChem CID 116555381) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is 2-anilino-1-(2,3-dihydro-1-benzofuran-5-yl)ethanone.
| Compound Name | 2-anilino-1-(2,3-dihydro-1-benzofuran-5-yl)ethanone |
|---|---|
| PubChem CID | 116555381 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 2-anilino-1-(2,3-dihydro-1-benzofuran-5-yl)ethanone |
| SMILES | O=C(CNc1ccccc1)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C16H15NO2/c18-15(11-17-14-4-2-1-3-5-14)12-6-7-16-13(10-12)8-9-19-16/h1-7,10,17H,8-9,11H2 |
| InChIKey | DQOPIMXGNDGKEC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |