C10H10O2 — CID 90352085
(E)-2-(2,3-dihydro-1-benzofuran-5-yl)ethenol (PubChem CID 90352085) has the molecular formula C10H10O2 and a molecular weight of 162.19 g/mol. Its IUPAC name is (E)-2-(2,3-dihydro-1-benzofuran-5-yl)ethenol.
| Compound Name | (E)-2-(2,3-dihydro-1-benzofuran-5-yl)ethenol |
|---|---|
| PubChem CID | 90352085 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | (E)-2-(2,3-dihydro-1-benzofuran-5-yl)ethenol |
| SMILES | O/C=C/c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C10H10O2/c11-5-3-8-1-2-10-9(7-8)4-6-12-10/h1-3,5,7,11H,4,6H2/b5-3+ |
| InChIKey | AHBNTVAAZULFCJ-HWKANZROSA-N |
| XLogP | 2.15 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|