C18H16O2S — CID 156783239
(E)-3-(2,3-dihydro-1-benzofuran-5-yl)-1-(4-methylsulfanylphenyl)prop-2-en-1-one (PubChem CID 156783239) has the molecular formula C18H16O2S and a molecular weight of 296.39 g/mol. Its IUPAC name is (E)-3-(2,3-dihydro-1-benzofuran-5-yl)-1-(4-methylsulfanylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(2,3-dihydro-1-benzofuran-5-yl)-1-(4-methylsulfanylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 156783239 |
| Molecular Formula | C18H16O2S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | (E)-3-(2,3-dihydro-1-benzofuran-5-yl)-1-(4-methylsulfanylphenyl)prop-2-en-1-one |
| SMILES | CSc1ccc(C(=O)/C=C/c2ccc3c(c2)CCO3)cc1 |
| InChI | InChI=1S/C18H16O2S/c1-21-16-6-4-14(5-7-16)17(19)8-2-13-3-9-18-15(12-13)10-11-20-18/h2-9,12H,10-11H2,1H3/b8-2+ |
| InChIKey | SYCIWORSGGMZAP-KRXBUXKQSA-N |
| XLogP | 4.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|