C17H14O3 — CID 170838343
(E)-1-(2,3-dihydro-1-benzofuran-5-yl)-3-(2-hydroxyphenyl)prop-2-en-1-one (PubChem CID 170838343) has the molecular formula C17H14O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is (E)-1-(2,3-dihydro-1-benzofuran-5-yl)-3-(2-hydroxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(2,3-dihydro-1-benzofuran-5-yl)-3-(2-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 170838343 |
| Molecular Formula | C17H14O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | (E)-1-(2,3-dihydro-1-benzofuran-5-yl)-3-(2-hydroxyphenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1O)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C17H14O3/c18-15-4-2-1-3-12(15)5-7-16(19)13-6-8-17-14(11-13)9-10-20-17/h1-8,11,18H,9-10H2/b7-5+ |
| InChIKey | ABBPMGOEMLGGCP-FNORWQNLSA-N |
| XLogP | 3.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|