C16H17NO3 — CID 171527682
(E)-N-cyclobutyl-4-(2,3-dihydro-1-benzofuran-5-yl)-4-oxobut-2-enamide (PubChem CID 171527682) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is (E)-N-cyclobutyl-4-(2,3-dihydro-1-benzofuran-5-yl)-4-oxobut-2-enamide.
| Compound Name | (E)-N-cyclobutyl-4-(2,3-dihydro-1-benzofuran-5-yl)-4-oxobut-2-enamide |
|---|---|
| PubChem CID | 171527682 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | (E)-N-cyclobutyl-4-(2,3-dihydro-1-benzofuran-5-yl)-4-oxobut-2-enamide |
| SMILES | O=C(/C=C/C(=O)c1ccc2c(c1)CCO2)NC1CCC1 |
| InChI | InChI=1S/C16H17NO3/c18-14(5-7-16(19)17-13-2-1-3-13)11-4-6-15-12(10-11)8-9-20-15/h4-7,10,13H,1-3,8-9H2,(H,17,19)/b7-5+ |
| InChIKey | SVVDWGUBCIBALM-FNORWQNLSA-N |
| XLogP | 2.03 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|