C15H18ClNO2 — CID 114296800
N-(4-chlorocyclohexyl)-2,3-dihydro-1-benzofuran-5-carboxamide (PubChem CID 114296800) has the molecular formula C15H18ClNO2 and a molecular weight of 279.77 g/mol. Its IUPAC name is N-(4-chlorocyclohexyl)-2,3-dihydro-1-benzofuran-5-carboxamide.
| Compound Name | N-(4-chlorocyclohexyl)-2,3-dihydro-1-benzofuran-5-carboxamide |
|---|---|
| PubChem CID | 114296800 |
| Molecular Formula | C15H18ClNO2 |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | N-(4-chlorocyclohexyl)-2,3-dihydro-1-benzofuran-5-carboxamide |
| SMILES | O=C(NC1CCC(Cl)CC1)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C15H18ClNO2/c16-12-2-4-13(5-3-12)17-15(18)11-1-6-14-10(9-11)7-8-19-14/h1,6,9,12-13H,2-5,7-8H2,(H,17,18) |
| InChIKey | RQKJLOJYKDXRJA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|