C18H20N2O4 — CID 171527617
(E)-1-(4-acetylpiperazin-1-yl)-4-(2,3-dihydro-1-benzofuran-5-yl)but-2-ene-1,4-dione (PubChem CID 171527617) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is (E)-1-(4-acetylpiperazin-1-yl)-4-(2,3-dihydro-1-benzofuran-5-yl)but-2-ene-1,4-dione.
| Compound Name | (E)-1-(4-acetylpiperazin-1-yl)-4-(2,3-dihydro-1-benzofuran-5-yl)but-2-ene-1,4-dione |
|---|---|
| PubChem CID | 171527617 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | (E)-1-(4-acetylpiperazin-1-yl)-4-(2,3-dihydro-1-benzofuran-5-yl)but-2-ene-1,4-dione |
| SMILES | CC(=O)N1CCN(C(=O)/C=C/C(=O)c2ccc3c(c2)CCO3)CC1 |
| InChI | InChI=1S/C18H20N2O4/c1-13(21)19-7-9-20(10-8-19)18(23)5-3-16(22)14-2-4-17-15(12-14)6-11-24-17/h2-5,12H,6-11H2,1H3/b5-3+ |
| InChIKey | CDYFTZSQHCIVCH-HWKANZROSA-N |
| XLogP | 1.05 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|