C21H29N3O4S — CID 24669752
(E)-1-[4-(azepan-1-ylsulfonyl)piperazin-1-yl]-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-en-1-one (PubChem CID 24669752) has the molecular formula C21H29N3O4S and a molecular weight of 419.55 g/mol. Its IUPAC name is (E)-1-[4-(azepan-1-ylsulfonyl)piperazin-1-yl]-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(azepan-1-ylsulfonyl)piperazin-1-yl]-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 24669752 |
| Molecular Formula | C21H29N3O4S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | (E)-1-[4-(azepan-1-ylsulfonyl)piperazin-1-yl]-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc2c(c1)CCO2)N1CCN(S(=O)(=O)N2CCCCCC2)CC1 |
| InChI | InChI=1S/C21H29N3O4S/c25-21(8-6-18-5-7-20-19(17-18)9-16-28-20)22-12-14-24(15-13-22)29(26,27)23-10-3-1-2-4-11-23/h5-8,17H,1-4,9-16H2/b8-6+ |
| InChIKey | SMKRFFCTFALIBW-SOFGYWHQSA-N |
| XLogP | 1.90 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|