C21H23N3O2 — CID 31915285
(E)-3-(2,3-dihydro-1-benzofuran-5-yl)-1-[4-(pyridin-2-ylmethyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 31915285) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is (E)-3-(2,3-dihydro-1-benzofuran-5-yl)-1-[4-(pyridin-2-ylmethyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(2,3-dihydro-1-benzofuran-5-yl)-1-[4-(pyridin-2-ylmethyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 31915285 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | (E)-3-(2,3-dihydro-1-benzofuran-5-yl)-1-[4-(pyridin-2-ylmethyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc2c(c1)CCO2)N1CCN(Cc2ccccn2)CC1 |
| InChI | InChI=1S/C21H23N3O2/c25-21(7-5-17-4-6-20-18(15-17)8-14-26-20)24-12-10-23(11-13-24)16-19-3-1-2-9-22-19/h1-7,9,15H,8,10-14,16H2/b7-5+ |
| InChIKey | NUKUSMGUPHZLNE-FNORWQNLSA-N |
| XLogP | 2.37 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|