C17H12BrFO2 — CID 170838357
(E)-3-(2-bromo-6-fluorophenyl)-1-(2,3-dihydro-1-benzofuran-5-yl)prop-2-en-1-one (PubChem CID 170838357) has the molecular formula C17H12BrFO2 and a molecular weight of 347.18 g/mol. Its IUPAC name is (E)-3-(2-bromo-6-fluorophenyl)-1-(2,3-dihydro-1-benzofuran-5-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(2-bromo-6-fluorophenyl)-1-(2,3-dihydro-1-benzofuran-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 170838357 |
| Molecular Formula | C17H12BrFO2 |
| Molecular Weight | 347.18 g/mol |
| Exact Mass | 346.00 |
| IUPAC Name | (E)-3-(2-bromo-6-fluorophenyl)-1-(2,3-dihydro-1-benzofuran-5-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1c(F)cccc1Br)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C17H12BrFO2/c18-14-2-1-3-15(19)13(14)5-6-16(20)11-4-7-17-12(10-11)8-9-21-17/h1-7,10H,8-9H2/b6-5+ |
| InChIKey | VKEJWQVJDBSIKF-AATRIKPKSA-N |
| XLogP | 4.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.18 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|