C11H9FO3 — CID 143200425
fluoro (E)-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enoate (PubChem CID 143200425) has the molecular formula C11H9FO3 and a molecular weight of 208.19 g/mol. Its IUPAC name is fluoro (E)-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enoate.
| Compound Name | fluoro (E)-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 143200425 |
| Molecular Formula | C11H9FO3 |
| Molecular Weight | 208.19 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | fluoro (E)-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc2c(c1)CCO2)OF |
| InChI | InChI=1S/C11H9FO3/c12-15-11(13)4-2-8-1-3-10-9(7-8)5-6-14-10/h1-4,7H,5-6H2/b4-2+ |
| InChIKey | FYSGZHSBJMNSKB-DUXPYHPUSA-N |
| XLogP | 2.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.19 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|