C12H13ClO — CID 170499269
5-(4-chlorobut-1-enyl)-2,3-dihydro-1-benzofuran (PubChem CID 170499269) has the molecular formula C12H13ClO and a molecular weight of 208.69 g/mol. Its IUPAC name is 5-(4-chlorobut-1-enyl)-2,3-dihydro-1-benzofuran.
| Compound Name | 5-(4-chlorobut-1-enyl)-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 170499269 |
| Molecular Formula | C12H13ClO |
| Molecular Weight | 208.69 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 5-(4-chlorobut-1-enyl)-2,3-dihydro-1-benzofuran |
| SMILES | ClCCC=Cc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C12H13ClO/c13-7-2-1-3-10-4-5-12-11(9-10)6-8-14-12/h1,3-5,9H,2,6-8H2 |
| InChIKey | HFXYQJPZKHKZSS-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.69 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|