C12H13ClO — CID 130539002
5-[(E)-3-chlorobut-1-enyl]-2,3-dihydro-1-benzofuran (PubChem CID 130539002) has the molecular formula C12H13ClO and a molecular weight of 208.69 g/mol. Its IUPAC name is 5-[(E)-3-chlorobut-1-enyl]-2,3-dihydro-1-benzofuran.
| Compound Name | 5-[(E)-3-chlorobut-1-enyl]-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 130539002 |
| Molecular Formula | C12H13ClO |
| Molecular Weight | 208.69 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 5-[(E)-3-chlorobut-1-enyl]-2,3-dihydro-1-benzofuran |
| SMILES | CC(Cl)/C=C/c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C12H13ClO/c1-9(13)2-3-10-4-5-12-11(8-10)6-7-14-12/h2-5,8-9H,6-7H2,1H3/b3-2+ |
| InChIKey | MWJAYACPFKAFFR-NSCUHMNNSA-N |
| XLogP | 3.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.69 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|