C16H19NO4 — CID 129410093
(2S)-3-[[(Z)-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enoyl]-methylamino]-2-methylpropanoic acid (PubChem CID 129410093) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is (2S)-3-[[(Z)-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enoyl]-methylamino]-2-methylpropanoic acid.
| Compound Name | (2S)-3-[[(Z)-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enoyl]-methylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 129410093 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | (2S)-3-[[(Z)-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enoyl]-methylamino]-2-methylpropanoic acid |
| SMILES | C[C@@H](CN(C)C(=O)/C=C\c1ccc2c(c1)CCO2)C(=O)O |
| InChI | InChI=1S/C16H19NO4/c1-11(16(19)20)10-17(2)15(18)6-4-12-3-5-14-13(9-12)7-8-21-14/h3-6,9,11H,7-8,10H2,1-2H3,(H,19,20)/b6-4-/t11-/m0/s1 |
| InChIKey | ZJLFBQFVGBTGSL-QZPNVGJNSA-N |
| XLogP | 1.81 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|