About 5,6-dihydro-1,7-phenanthroline
5,6-dihydro-1,7-phenanthroline (PubChem CID 69016308) has the molecular formula C12H10N2
and a molecular weight of 182.23 g/mol. Its IUPAC name is 5,6-dihydro-1,7-phenanthroline.
Molecular Properties
| Compound Name | 5,6-dihydro-1,7-phenanthroline |
| PubChem CID | 69016308 |
| Molecular Formula | C12H10N2 |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 5,6-dihydro-1,7-phenanthroline |
| SMILES | c1cnc2c(c1)CCc1ncccc1-2 |
| InChI | InChI=1S/C12H10N2/c1-3-9-5-6-11-10(4-2-7-13-11)12(9)14-8-1/h1-4,7-8H,5-6H2 |
| InChIKey | JTEBTOAYDVITQS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,6-dihydro-1,7-phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihydro-1,7-phenanthroline?
The IUPAC name of 5,6-dihydro-1,7-phenanthroline (CID 69016308) is 5,6-dihydro-1,7-phenanthroline.
What is the SMILES notation for 5,6-dihydro-1,7-phenanthroline?
The canonical SMILES for 5,6-dihydro-1,7-phenanthroline is c1cnc2c(c1)CCc1ncccc1-2.
What is the InChIKey of 5,6-dihydro-1,7-phenanthroline?
The InChIKey is JTEBTOAYDVITQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2/c1-3-9-5-6-11-10(4-2-7-13-11)12(9)14-8-1/h1-4,7-8H,5-6H2.
What are the key properties of 5,6-dihydro-1,7-phenanthroline?
5,6-dihydro-1,7-phenanthroline has a molecular weight of 182.23 g/mol, XLogP of 2.24, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydro-1,7-phenanthroline is sourced from PubChem (CID 69016308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).