C17H22 — CID 143520012
ethane;2-ethenyl-7-methyl-3-[(Z)-prop-1-enyl]-1H-indene (PubChem CID 143520012) has the molecular formula C17H22 and a molecular weight of 226.36 g/mol. Its IUPAC name is ethane;2-ethenyl-7-methyl-3-[(Z)-prop-1-enyl]-1H-indene.
| Compound Name | ethane;2-ethenyl-7-methyl-3-[(Z)-prop-1-enyl]-1H-indene |
|---|---|
| PubChem CID | 143520012 |
| Molecular Formula | C17H22 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | ethane;2-ethenyl-7-methyl-3-[(Z)-prop-1-enyl]-1H-indene |
| SMILES | C=CC1=C(/C=C\C)c2cccc(C)c2C1.CC |
| InChI | InChI=1S/C15H16.C2H6/c1-4-7-13-12(5-2)10-15-11(3)8-6-9-14(13)15;1-2/h4-9H,2,10H2,1,3H3;1-2H3/b7-4-; |
| InChIKey | MCMQFTTYKKWOQZ-ZULQGGHCSA-N |
| XLogP | 5.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |