C24H22 — CID 159429111
(8Z,10Z)-8,9-bis(ethenyl)-11-methyl-10-[(Z)-prop-1-enyl]tricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,8,10,12,14-octaene (PubChem CID 159429111) has the molecular formula C24H22 and a molecular weight of 310.44 g/mol. Its IUPAC name is (8Z,10Z)-8,9-bis(ethenyl)-11-methyl-10-[(Z)-prop-1-enyl]tricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,8,10,12,14-octaene.
| Compound Name | (8Z,10Z)-8,9-bis(ethenyl)-11-methyl-10-[(Z)-prop-1-enyl]tricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,8,10,12,14-octaene |
|---|---|
| PubChem CID | 159429111 |
| Molecular Formula | C24H22 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | (8Z,10Z)-8,9-bis(ethenyl)-11-methyl-10-[(Z)-prop-1-enyl]tricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,8,10,12,14-octaene |
| SMILES | C=C/C1=C(\C=C)c2ccccc2-c2ccccc2C(C)=C1/C=C\C |
| InChI | InChI=1S/C24H22/c1-5-12-20-17(4)21-13-8-9-15-23(21)24-16-11-10-14-22(24)19(7-3)18(20)6-2/h5-16H,2-3H2,1,4H3/b12-5-,19-18-,20-17-,20-18-,21-17-,22-19-,24-23- |
| InChIKey | LQTIHBYICFROMN-FAMNQNRTSA-N |
| XLogP | 6.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |