C16H19N — CID 143596104
ethane;2-ethenyl-3-[(Z)-prop-1-enyl]inden-1-imine (PubChem CID 143596104) has the molecular formula C16H19N and a molecular weight of 225.33 g/mol. Its IUPAC name is ethane;2-ethenyl-3-[(Z)-prop-1-enyl]inden-1-imine.
| Compound Name | ethane;2-ethenyl-3-[(Z)-prop-1-enyl]inden-1-imine |
|---|---|
| PubChem CID | 143596104 |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | ethane;2-ethenyl-3-[(Z)-prop-1-enyl]inden-1-imine |
| SMILES | CC.[H]/N=C1/C(C=C)=C(/C=C\C)c2ccccc21 |
| InChI | InChI=1S/C14H13N.C2H6/c1-3-7-11-10(4-2)14(15)13-9-6-5-8-12(11)13;1-2/h3-9,15H,2H2,1H3;1-2H3/b7-3-,15-14-; |
| InChIKey | SCGQSENUNFHXBS-ZALJDOQVSA-N |
| XLogP | 4.61 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|