C19H18IO6- — CID 154693342
2-benzofuran-1,3-dione;3-ethenyl-4-[(Z)-prop-1-enyl]furan-2,5-dione;methyliodanuidylmethane (PubChem CID 154693342) has the molecular formula C19H18IO6- and a molecular weight of 469.25 g/mol. Its IUPAC name is 2-benzofuran-1,3-dione;3-ethenyl-4-[(Z)-prop-1-enyl]furan-2,5-dione;methyliodanuidylmethane.
| Compound Name | 2-benzofuran-1,3-dione;3-ethenyl-4-[(Z)-prop-1-enyl]furan-2,5-dione;methyliodanuidylmethane |
|---|---|
| PubChem CID | 154693342 |
| Molecular Formula | C19H18IO6- |
| Molecular Weight | 469.25 g/mol |
| Exact Mass | 469.02 |
| IUPAC Name | 2-benzofuran-1,3-dione;3-ethenyl-4-[(Z)-prop-1-enyl]furan-2,5-dione;methyliodanuidylmethane |
| SMILES | C=CC1=C(/C=C\C)C(=O)OC1=O.C[I-]C.O=C1OC(=O)c2ccccc21 |
| InChI | InChI=1S/C9H8O3.C8H4O3.C2H6I/c1-3-5-7-6(4-2)8(10)12-9(7)11;9-7-5-3-1-2-4-6(5)8(10)11-7;1-3-2/h3-5H,2H2,1H3;1-4H;1-2H3/q;;-1/b5-3-;; |
| InChIKey | UAGFBGKOEHGEHL-ORIPCLHRSA-N |
| XLogP | -0.54 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.25 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|