About 2-benzofuran-1,3-dione;ethane;molecular iodine
2-benzofuran-1,3-dione;ethane;molecular iodine (PubChem CID 160781594) has the molecular formula C10H10I2O3
and a molecular weight of 432.00 g/mol. Its IUPAC name is 2-benzofuran-1,3-dione;ethane;molecular iodine.
Molecular Properties
| Compound Name | 2-benzofuran-1,3-dione;ethane;molecular iodine |
| PubChem CID | 160781594 |
| Molecular Formula | C10H10I2O3 |
| Molecular Weight | 432.00 g/mol |
| Exact Mass | 431.87 |
| IUPAC Name | 2-benzofuran-1,3-dione;ethane;molecular iodine |
| SMILES | CC.II.O=C1OC(=O)c2ccccc21 |
| InChI | InChI=1S/C8H4O3.C2H6.I2/c9-7-5-3-1-2-4-6(5)8(10)11-7;2*1-2/h1-4H;1-2H3; |
| InChIKey | SAQQIHNMPBXJSM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.00 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-benzofuran-1,3-dione;ethane;molecular iodine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzofuran-1,3-dione;ethane;molecular iodine?
The IUPAC name of 2-benzofuran-1,3-dione;ethane;molecular iodine (CID 160781594) is 2-benzofuran-1,3-dione;ethane;molecular iodine.
What is the SMILES notation for 2-benzofuran-1,3-dione;ethane;molecular iodine?
The canonical SMILES for 2-benzofuran-1,3-dione;ethane;molecular iodine is CC.II.O=C1OC(=O)c2ccccc21.
What is the InChIKey of 2-benzofuran-1,3-dione;ethane;molecular iodine?
The InChIKey is SAQQIHNMPBXJSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4O3.C2H6.I2/c9-7-5-3-1-2-4-6(5)8(10)11-7;2*1-2/h1-4H;1-2H3;.
What are the key properties of 2-benzofuran-1,3-dione;ethane;molecular iodine?
2-benzofuran-1,3-dione;ethane;molecular iodine has a molecular weight of 432.00 g/mol, XLogP of 3.79, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzofuran-1,3-dione;ethane;molecular iodine is sourced from PubChem (CID 160781594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).