About bis(2-benzofuran-1,3-dione);ethoxyethane
bis(2-benzofuran-1,3-dione);ethoxyethane (PubChem CID 87972928) has the molecular formula C20H18O7
and a molecular weight of 370.36 g/mol. Its IUPAC name is bis(2-benzofuran-1,3-dione);ethoxyethane.
Molecular Properties
| Compound Name | bis(2-benzofuran-1,3-dione);ethoxyethane |
| PubChem CID | 87972928 |
| Molecular Formula | C20H18O7 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | bis(2-benzofuran-1,3-dione);ethoxyethane |
| SMILES | CCOCC.O=C1OC(=O)c2ccccc21.O=C1OC(=O)c2ccccc21 |
| InChI | InChI=1S/2C8H4O3.C4H10O/c2*9-7-5-3-1-2-4-6(5)8(10)11-7;1-3-5-4-2/h2*1-4H;3-4H2,1-2H3 |
| InChIKey | SVZXCFGZQZLESN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze bis(2-benzofuran-1,3-dione);ethoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-benzofuran-1,3-dione);ethoxyethane?
The IUPAC name of bis(2-benzofuran-1,3-dione);ethoxyethane (CID 87972928) is bis(2-benzofuran-1,3-dione);ethoxyethane.
What is the SMILES notation for bis(2-benzofuran-1,3-dione);ethoxyethane?
The canonical SMILES for bis(2-benzofuran-1,3-dione);ethoxyethane is CCOCC.O=C1OC(=O)c2ccccc21.O=C1OC(=O)c2ccccc21.
What is the InChIKey of bis(2-benzofuran-1,3-dione);ethoxyethane?
The InChIKey is SVZXCFGZQZLESN-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H4O3.C4H10O/c2*9-7-5-3-1-2-4-6(5)8(10)11-7;1-3-5-4-2/h2*1-4H;3-4H2,1-2H3.
What are the key properties of bis(2-benzofuran-1,3-dione);ethoxyethane?
bis(2-benzofuran-1,3-dione);ethoxyethane has a molecular weight of 370.36 g/mol, XLogP of 3.04, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-benzofuran-1,3-dione);ethoxyethane is sourced from PubChem (CID 87972928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).