About 2-benzofuran-1,3-dione;ethanamine;trifluoroborane
2-benzofuran-1,3-dione;ethanamine;trifluoroborane (PubChem CID 159616392) has the molecular formula C10H11BF3NO3
and a molecular weight of 261.01 g/mol. Its IUPAC name is 2-benzofuran-1,3-dione;ethanamine;trifluoroborane.
Molecular Properties
| Compound Name | 2-benzofuran-1,3-dione;ethanamine;trifluoroborane |
| PubChem CID | 159616392 |
| Molecular Formula | C10H11BF3NO3 |
| Molecular Weight | 261.01 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 2-benzofuran-1,3-dione;ethanamine;trifluoroborane |
| SMILES | CCN.FB(F)F.O=C1OC(=O)c2ccccc21 |
| InChI | InChI=1S/C8H4O3.C2H7N.BF3/c9-7-5-3-1-2-4-6(5)8(10)11-7;1-2-3;2-1(3)4/h1-4H;2-3H2,1H3; |
| InChIKey | MNIKAVJEZXOMDA-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.01 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-benzofuran-1,3-dione;ethanamine;trifluoroborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzofuran-1,3-dione;ethanamine;trifluoroborane?
The IUPAC name of 2-benzofuran-1,3-dione;ethanamine;trifluoroborane (CID 159616392) is 2-benzofuran-1,3-dione;ethanamine;trifluoroborane.
What is the SMILES notation for 2-benzofuran-1,3-dione;ethanamine;trifluoroborane?
The canonical SMILES for 2-benzofuran-1,3-dione;ethanamine;trifluoroborane is CCN.FB(F)F.O=C1OC(=O)c2ccccc21.
What is the InChIKey of 2-benzofuran-1,3-dione;ethanamine;trifluoroborane?
The InChIKey is MNIKAVJEZXOMDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4O3.C2H7N.BF3/c9-7-5-3-1-2-4-6(5)8(10)11-7;1-2-3;2-1(3)4/h1-4H;2-3H2,1H3;.
What are the key properties of 2-benzofuran-1,3-dione;ethanamine;trifluoroborane?
2-benzofuran-1,3-dione;ethanamine;trifluoroborane has a molecular weight of 261.01 g/mol, XLogP of 1.84, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzofuran-1,3-dione;ethanamine;trifluoroborane is sourced from PubChem (CID 159616392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).