About 2-benzofuran-1,3-dione;urea
2-benzofuran-1,3-dione;urea (PubChem CID 87353578) has the molecular formula C9H8N2O4
and a molecular weight of 208.17 g/mol. Its IUPAC name is 2-benzofuran-1,3-dione;urea.
Molecular Properties
| Compound Name | 2-benzofuran-1,3-dione;urea |
| PubChem CID | 87353578 |
| Molecular Formula | C9H8N2O4 |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 2-benzofuran-1,3-dione;urea |
| SMILES | NC(N)=O.O=C1OC(=O)c2ccccc21 |
| InChI | InChI=1S/C8H4O3.CH4N2O/c9-7-5-3-1-2-4-6(5)8(10)11-7;2-1(3)4/h1-4H;(H4,2,3,4) |
| InChIKey | HCXVRWNMKLEOKO-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-benzofuran-1,3-dione;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzofuran-1,3-dione;urea?
The IUPAC name of 2-benzofuran-1,3-dione;urea (CID 87353578) is 2-benzofuran-1,3-dione;urea.
What is the SMILES notation for 2-benzofuran-1,3-dione;urea?
The canonical SMILES for 2-benzofuran-1,3-dione;urea is NC(N)=O.O=C1OC(=O)c2ccccc21.
What is the InChIKey of 2-benzofuran-1,3-dione;urea?
The InChIKey is HCXVRWNMKLEOKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4O3.CH4N2O/c9-7-5-3-1-2-4-6(5)8(10)11-7;2-1(3)4/h1-4H;(H4,2,3,4).
What are the key properties of 2-benzofuran-1,3-dione;urea?
2-benzofuran-1,3-dione;urea has a molecular weight of 208.17 g/mol, XLogP of 0.02, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzofuran-1,3-dione;urea is sourced from PubChem (CID 87353578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).