About CID 87935990
CID 87935990 (PubChem CID 87935990) has the molecular formula C8H4O4Si2
and a molecular weight of 220.29 g/mol.
Molecular Properties
| Compound Name | CID 87935990 |
| PubChem CID | 87935990 |
| Molecular Formula | C8H4O4Si2 |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 219.96 |
| IUPAC Name | — |
| SMILES | O=C1OC(=O)c2ccccc21.[Si]O[Si] |
| InChI | InChI=1S/C8H4O3.OSi2/c9-7-5-3-1-2-4-6(5)8(10)11-7;2-1-3/h1-4H; |
| InChIKey | DLNDGUOKXRBJME-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 87935990 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87935990?
The IUPAC name of CID 87935990 (CID 87935990) is not available.
What is the SMILES notation for CID 87935990?
The canonical SMILES for CID 87935990 is O=C1OC(=O)c2ccccc21.[Si]O[Si].
What is the InChIKey of CID 87935990?
The InChIKey is DLNDGUOKXRBJME-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4O3.OSi2/c9-7-5-3-1-2-4-6(5)8(10)11-7;2-1-3/h1-4H;.
What are the key properties of CID 87935990?
CID 87935990 has a molecular weight of 220.29 g/mol, XLogP of 0.17, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87935990 is sourced from PubChem (CID 87935990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).