C24H22O6 — CID 167655999
2-benzofuran-1,3-dione;ethane;3-oxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-2,4-dione (PubChem CID 167655999) has the molecular formula C24H22O6 and a molecular weight of 406.43 g/mol. Its IUPAC name is 2-benzofuran-1,3-dione;ethane;3-oxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-2,4-dione.
| Compound Name | 2-benzofuran-1,3-dione;ethane;3-oxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-2,4-dione |
|---|---|
| PubChem CID | 167655999 |
| Molecular Formula | C24H22O6 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 2-benzofuran-1,3-dione;ethane;3-oxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-2,4-dione |
| SMILES | CC.CC.O=C1OC(=O)c2cccc3cccc1c23.O=C1OC(=O)c2ccccc21 |
| InChI | InChI=1S/C12H6O3.C8H4O3.2C2H6/c13-11-8-5-1-3-7-4-2-6-9(10(7)8)12(14)15-11;9-7-5-3-1-2-4-6(5)8(10)11-7;2*1-2/h1-6H;1-4H;2*1-2H3 |
| InChIKey | RGPGYCBYNUEXRH-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|