About benzo[k]fluoranthene;ethane
benzo[k]fluoranthene;ethane (PubChem CID 142369852) has the molecular formula C22H18
and a molecular weight of 282.39 g/mol. Its IUPAC name is benzo[k]fluoranthene;ethane.
Molecular Properties
| Compound Name | benzo[k]fluoranthene;ethane |
| PubChem CID | 142369852 |
| Molecular Formula | C22H18 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | benzo[k]fluoranthene;ethane |
| SMILES | CC.c1ccc2cc3c(cc2c1)-c1cccc2cccc-3c12 |
| InChI | InChI=1S/C20H12.C2H6/c1-2-6-15-12-19-17-10-4-8-13-7-3-9-16(20(13)17)18(19)11-14(15)5-1;1-2/h1-12H;1-2H3 |
| InChIKey | OBHQDHLOMZVZAV-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze benzo[k]fluoranthene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[k]fluoranthene;ethane?
The IUPAC name of benzo[k]fluoranthene;ethane (CID 142369852) is benzo[k]fluoranthene;ethane.
What is the SMILES notation for benzo[k]fluoranthene;ethane?
The canonical SMILES for benzo[k]fluoranthene;ethane is CC.c1ccc2cc3c(cc2c1)-c1cccc2cccc-3c12.
What is the InChIKey of benzo[k]fluoranthene;ethane?
The InChIKey is OBHQDHLOMZVZAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12.C2H6/c1-2-6-15-12-19-17-10-4-8-13-7-3-9-16(20(13)17)18(19)11-14(15)5-1;1-2/h1-12H;1-2H3.
What are the key properties of benzo[k]fluoranthene;ethane?
benzo[k]fluoranthene;ethane has a molecular weight of 282.39 g/mol, XLogP of 6.67, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[k]fluoranthene;ethane is sourced from PubChem (CID 142369852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).