About anthracene;fluoranthene;9H-fluorene
anthracene;fluoranthene;9H-fluorene (PubChem CID 162240077) has the molecular formula C43H30
and a molecular weight of 546.71 g/mol. Its IUPAC name is anthracene;fluoranthene;9H-fluorene.
Molecular Properties
| Compound Name | anthracene;fluoranthene;9H-fluorene |
| PubChem CID | 162240077 |
| Molecular Formula | C43H30 |
| Molecular Weight | 546.71 g/mol |
| Exact Mass | 546.23 |
| IUPAC Name | anthracene;fluoranthene;9H-fluorene |
| SMILES | c1ccc2c(c1)-c1cccc3cccc-2c13.c1ccc2c(c1)Cc1ccccc1-2.c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C16H10.C14H10.C13H10/c1-2-8-13-12(7-1)14-9-3-5-11-6-4-10-15(13)16(11)14;1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12/h1-10H;1-10H;1-8H,9H2 |
| InChIKey | ZWOUOAMFHVSBMN-UHFFFAOYSA-N |
| XLogP | 11.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 546.71 |
| LogP ≤ 5 | 11.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze anthracene;fluoranthene;9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene;fluoranthene;9H-fluorene?
The IUPAC name of anthracene;fluoranthene;9H-fluorene (CID 162240077) is anthracene;fluoranthene;9H-fluorene.
What is the SMILES notation for anthracene;fluoranthene;9H-fluorene?
The canonical SMILES for anthracene;fluoranthene;9H-fluorene is c1ccc2c(c1)-c1cccc3cccc-2c13.c1ccc2c(c1)Cc1ccccc1-2.c1ccc2cc3ccccc3cc2c1.
What is the InChIKey of anthracene;fluoranthene;9H-fluorene?
The InChIKey is ZWOUOAMFHVSBMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10.C14H10.C13H10/c1-2-8-13-12(7-1)14-9-3-5-11-6-4-10-15(13)16(11)14;1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12/h1-10H;1-10H;1-8H,9H2.
What are the key properties of anthracene;fluoranthene;9H-fluorene?
anthracene;fluoranthene;9H-fluorene has a molecular weight of 546.71 g/mol, XLogP of 11.74, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene;fluoranthene;9H-fluorene is sourced from PubChem (CID 162240077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).