C31H36 — CID 158482516
1,2-dihydroacenaphthylene;9H-fluorene;propane (PubChem CID 158482516) has the molecular formula C31H36 and a molecular weight of 408.63 g/mol. Its IUPAC name is 1,2-dihydroacenaphthylene;9H-fluorene;propane.
| Compound Name | 1,2-dihydroacenaphthylene;9H-fluorene;propane |
|---|---|
| PubChem CID | 158482516 |
| Molecular Formula | C31H36 |
| Molecular Weight | 408.63 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | 1,2-dihydroacenaphthylene;9H-fluorene;propane |
| SMILES | CCC.CCC.c1cc2c3c(cccc3c1)CC2.c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H10.C12H10.2C3H8/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-3-9-4-2-6-11-8-7-10(5-1)12(9)11;2*1-3-2/h1-8H,9H2;1-6H,7-8H2;2*3H2,1-2H3 |
| InChIKey | HHRPFNIVUYGFPQ-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.63 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |