About ethane;fluoranthene;3-methylpentane
ethane;fluoranthene;3-methylpentane (PubChem CID 90824236) has the molecular formula C28H42
and a molecular weight of 378.64 g/mol. Its IUPAC name is ethane;fluoranthene;3-methylpentane.
Molecular Properties
| Compound Name | ethane;fluoranthene;3-methylpentane |
| PubChem CID | 90824236 |
| Molecular Formula | C28H42 |
| Molecular Weight | 378.64 g/mol |
| Exact Mass | 378.33 |
| IUPAC Name | ethane;fluoranthene;3-methylpentane |
| SMILES | CC.CC.CC.CCC(C)CC.c1ccc2c(c1)-c1cccc3cccc-2c13 |
| InChI | InChI=1S/C16H10.C6H14.3C2H6/c1-2-8-13-12(7-1)14-9-3-5-11-6-4-10-15(13)16(11)14;1-4-6(3)5-2;3*1-2/h1-10H;6H,4-5H2,1-3H3;3*1-2H3 |
| InChIKey | SNIJCMFIMMKHQM-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.64 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;fluoranthene;3-methylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;fluoranthene;3-methylpentane?
The IUPAC name of ethane;fluoranthene;3-methylpentane (CID 90824236) is ethane;fluoranthene;3-methylpentane.
What is the SMILES notation for ethane;fluoranthene;3-methylpentane?
The canonical SMILES for ethane;fluoranthene;3-methylpentane is CC.CC.CC.CCC(C)CC.c1ccc2c(c1)-c1cccc3cccc-2c13.
What is the InChIKey of ethane;fluoranthene;3-methylpentane?
The InChIKey is SNIJCMFIMMKHQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10.C6H14.3C2H6/c1-2-8-13-12(7-1)14-9-3-5-11-6-4-10-15(13)16(11)14;1-4-6(3)5-2;3*1-2/h1-10H;6H,4-5H2,1-3H3;3*1-2H3.
What are the key properties of ethane;fluoranthene;3-methylpentane?
ethane;fluoranthene;3-methylpentane has a molecular weight of 378.64 g/mol, XLogP of 10.01, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;fluoranthene;3-methylpentane is sourced from PubChem (CID 90824236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).