C29H24N2 — CID 145241491
(13Z)-10,13,14-tris(ethenyl)-11-[(Z)-prop-1-enyl]-9,22-diazapentacyclo[13.7.0.02,7.08,12.016,21]docosa-1(15),2,4,6,8(12),10,13,16,18,20-decaene (PubChem CID 145241491) has the molecular formula C29H24N2 and a molecular weight of 400.53 g/mol. Its IUPAC name is (13Z)-10,13,14-tris(ethenyl)-11-[(Z)-prop-1-enyl]-9,22-diazapentacyclo[13.7.0.02,7.08,12.016,21]docosa-1(15),2,4,6,8(12),10,13,16,18,20-decaene.
| Compound Name | (13Z)-10,13,14-tris(ethenyl)-11-[(Z)-prop-1-enyl]-9,22-diazapentacyclo[13.7.0.02,7.08,12.016,21]docosa-1(15),2,4,6,8(12),10,13,16,18,20-decaene |
|---|---|
| PubChem CID | 145241491 |
| Molecular Formula | C29H24N2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | (13Z)-10,13,14-tris(ethenyl)-11-[(Z)-prop-1-enyl]-9,22-diazapentacyclo[13.7.0.02,7.08,12.016,21]docosa-1(15),2,4,6,8(12),10,13,16,18,20-decaene |
| SMILES | C=C/C1=C(\C=C)c2c([nH]c3ccccc23)-c2ccccc2-c2[nH]c(C=C)c(/C=C\C)c21 |
| InChI | InChI=1S/C29H24N2/c1-5-13-22-24(8-4)30-28-20-14-9-10-15-21(20)29-27(19(7-3)18(6-2)26(22)28)23-16-11-12-17-25(23)31-29/h5-17,30-31H,2-4H2,1H3/b13-5-,19-18-,26-18-,27-19-,28-20+,29-21+ |
| InChIKey | HCQLUFODAPNQDV-MZQSTQOWSA-N |
| XLogP | 8.10 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |