C23H25N3O2S — CID 142044354
4-ethenyl-8-hydroxy-5-[(Z)-prop-1-enyl]-3,9,19-triazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1,4,6,11,13,15,17-heptaen-10-one;methane;methanethiol (PubChem CID 142044354) has the molecular formula C23H25N3O2S and a molecular weight of 407.54 g/mol. Its IUPAC name is 4-ethenyl-8-hydroxy-5-[(Z)-prop-1-enyl]-3,9,19-triazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1,4,6,11,13,15,17-heptaen-10-one;methane;methanethiol.
| Compound Name | 4-ethenyl-8-hydroxy-5-[(Z)-prop-1-enyl]-3,9,19-triazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1,4,6,11,13,15,17-heptaen-10-one;methane;methanethiol |
|---|---|
| PubChem CID | 142044354 |
| Molecular Formula | C23H25N3O2S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 4-ethenyl-8-hydroxy-5-[(Z)-prop-1-enyl]-3,9,19-triazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1,4,6,11,13,15,17-heptaen-10-one;methane;methanethiol |
| SMILES | C.C=Cc1[nH]c2c(c1/C=C\C)c1c(c3c4ccccc4[nH]c23)C(=O)NC1O.CS |
| InChI | InChI=1S/C21H17N3O2.CH4S.CH4/c1-3-7-10-12(4-2)22-18-14(10)16-17(21(26)24-20(16)25)15-11-8-5-6-9-13(11)23-19(15)18;1-2;/h3-9,20,22-23,25H,2H2,1H3,(H,24,26);2H,1H3;1H4/b7-3-;; |
| InChIKey | QEUXCLOYAOTKHR-NAMRTZQUSA-N |
| XLogP | 5.39 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|