C22H24N2 — CID 145126089
ethene;2-ethenyl-3-[(Z)-prop-1-enyl]-1,10-dihydropyrrolo[2,3-a]carbazole;methane (PubChem CID 145126089) has the molecular formula C22H24N2 and a molecular weight of 316.45 g/mol. Its IUPAC name is ethene;2-ethenyl-3-[(Z)-prop-1-enyl]-1,10-dihydropyrrolo[2,3-a]carbazole;methane.
| Compound Name | ethene;2-ethenyl-3-[(Z)-prop-1-enyl]-1,10-dihydropyrrolo[2,3-a]carbazole;methane |
|---|---|
| PubChem CID | 145126089 |
| Molecular Formula | C22H24N2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | ethene;2-ethenyl-3-[(Z)-prop-1-enyl]-1,10-dihydropyrrolo[2,3-a]carbazole;methane |
| SMILES | C.C=C.C=Cc1[nH]c2c(ccc3c4ccccc4[nH]c32)c1/C=C\C |
| InChI | InChI=1S/C19H16N2.C2H4.CH4/c1-3-7-12-14-10-11-15-13-8-5-6-9-17(13)21-19(15)18(14)20-16(12)4-2;1-2;/h3-11,20-21H,2H2,1H3;1-2H2;1H4/b7-3-;; |
| InChIKey | HKUVGWFGMNUHPW-NAMRTZQUSA-N |
| XLogP | 6.92 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|