About 1-ethenyl-9H-carbazole;prop-2-enoic acid
1-ethenyl-9H-carbazole;prop-2-enoic acid (PubChem CID 167561200) has the molecular formula C17H15NO2
and a molecular weight of 265.31 g/mol. Its IUPAC name is 1-ethenyl-9H-carbazole;prop-2-enoic acid.
Molecular Properties
| Compound Name | 1-ethenyl-9H-carbazole;prop-2-enoic acid |
| PubChem CID | 167561200 |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 1-ethenyl-9H-carbazole;prop-2-enoic acid |
| SMILES | C=CC(=O)O.C=Cc1cccc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C14H11N.C3H4O2/c1-2-10-6-5-8-12-11-7-3-4-9-13(11)15-14(10)12;1-2-3(4)5/h2-9,15H,1H2;2H,1H2,(H,4,5) |
| InChIKey | DRHYOJPAKFDWNE-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenyl-9H-carbazole;prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-9H-carbazole;prop-2-enoic acid?
The IUPAC name of 1-ethenyl-9H-carbazole;prop-2-enoic acid (CID 167561200) is 1-ethenyl-9H-carbazole;prop-2-enoic acid.
What is the SMILES notation for 1-ethenyl-9H-carbazole;prop-2-enoic acid?
The canonical SMILES for 1-ethenyl-9H-carbazole;prop-2-enoic acid is C=CC(=O)O.C=Cc1cccc2c1[nH]c1ccccc12.
What is the InChIKey of 1-ethenyl-9H-carbazole;prop-2-enoic acid?
The InChIKey is DRHYOJPAKFDWNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N.C3H4O2/c1-2-10-6-5-8-12-11-7-3-4-9-13(11)15-14(10)12;1-2-3(4)5/h2-9,15H,1H2;2H,1H2,(H,4,5).
What are the key properties of 1-ethenyl-9H-carbazole;prop-2-enoic acid?
1-ethenyl-9H-carbazole;prop-2-enoic acid has a molecular weight of 265.31 g/mol, XLogP of 4.22, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-9H-carbazole;prop-2-enoic acid is sourced from PubChem (CID 167561200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).