C22H19N — CID 170336625
benzene;1,2-bis(ethenyl)-9H-carbazole (PubChem CID 170336625) has the molecular formula C22H19N and a molecular weight of 297.40 g/mol. Its IUPAC name is benzene;1,2-bis(ethenyl)-9H-carbazole.
| Compound Name | benzene;1,2-bis(ethenyl)-9H-carbazole |
|---|---|
| PubChem CID | 170336625 |
| Molecular Formula | C22H19N |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | benzene;1,2-bis(ethenyl)-9H-carbazole |
| SMILES | C=Cc1ccc2c([nH]c3ccccc32)c1C=C.c1ccccc1 |
| InChI | InChI=1S/C16H13N.C6H6/c1-3-11-9-10-14-13-7-5-6-8-15(13)17-16(14)12(11)4-2;1-2-4-6-5-3-1/h3-10,17H,1-2H2;1-6H |
| InChIKey | JIBALWCZJVRZAG-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |