About ethane;3-ethenyl-2-[(Z)-prop-1-enyl]-1H-indole;3-propyl-9H-carbazole
ethane;3-ethenyl-2-[(Z)-prop-1-enyl]-1H-indole;3-propyl-9H-carbazole (PubChem CID 144821210) has the molecular formula C30H34N2
and a molecular weight of 422.62 g/mol. Its IUPAC name is ethane;3-ethenyl-2-[(Z)-prop-1-enyl]-1H-indole;3-propyl-9H-carbazole.
Molecular Properties
| Compound Name | ethane;3-ethenyl-2-[(Z)-prop-1-enyl]-1H-indole;3-propyl-9H-carbazole |
| PubChem CID | 144821210 |
| Molecular Formula | C30H34N2 |
| Molecular Weight | 422.62 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | ethane;3-ethenyl-2-[(Z)-prop-1-enyl]-1H-indole;3-propyl-9H-carbazole |
| SMILES | C=Cc1c(/C=C\C)[nH]c2ccccc12.CC.CCCc1ccc2[nH]c3ccccc3c2c1 |
| InChI | InChI=1S/C15H15N.C13H13N.C2H6/c1-2-5-11-8-9-15-13(10-11)12-6-3-4-7-14(12)16-15;1-3-7-12-10(4-2)11-8-5-6-9-13(11)14-12;1-2/h3-4,6-10,16H,2,5H2,1H3;3-9,14H,2H2,1H3;1-2H3/b;7-3-; |
| InChIKey | BYTSALGMZFWHCJ-XSXGVBCLSA-N |
| XLogP | 9.14 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.62 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;3-ethenyl-2-[(Z)-prop-1-enyl]-1H-indole;3-propyl-9H-carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-ethenyl-2-[(Z)-prop-1-enyl]-1H-indole;3-propyl-9H-carbazole?
The IUPAC name of ethane;3-ethenyl-2-[(Z)-prop-1-enyl]-1H-indole;3-propyl-9H-carbazole (CID 144821210) is ethane;3-ethenyl-2-[(Z)-prop-1-enyl]-1H-indole;3-propyl-9H-carbazole.
What is the SMILES notation for ethane;3-ethenyl-2-[(Z)-prop-1-enyl]-1H-indole;3-propyl-9H-carbazole?
The canonical SMILES for ethane;3-ethenyl-2-[(Z)-prop-1-enyl]-1H-indole;3-propyl-9H-carbazole is C=Cc1c(/C=C\C)[nH]c2ccccc12.CC.CCCc1ccc2[nH]c3ccccc3c2c1.
What is the InChIKey of ethane;3-ethenyl-2-[(Z)-prop-1-enyl]-1H-indole;3-propyl-9H-carbazole?
The InChIKey is BYTSALGMZFWHCJ-XSXGVBCLSA-N. The full InChI is InChI=1S/C15H15N.C13H13N.C2H6/c1-2-5-11-8-9-15-13(10-11)12-6-3-4-7-14(12)16-15;1-3-7-12-10(4-2)11-8-5-6-9-13(11)14-12;1-2/h3-4,6-10,16H,2,5H2,1H3;3-9,14H,2H2,1H3;1-2H3/b;7-3-;.
What are the key properties of ethane;3-ethenyl-2-[(Z)-prop-1-enyl]-1H-indole;3-propyl-9H-carbazole?
ethane;3-ethenyl-2-[(Z)-prop-1-enyl]-1H-indole;3-propyl-9H-carbazole has a molecular weight of 422.62 g/mol, XLogP of 9.14, 4 rotatable bonds, 2 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-ethenyl-2-[(Z)-prop-1-enyl]-1H-indole;3-propyl-9H-carbazole is sourced from PubChem (CID 144821210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).