C30H33N — CID 177144901
2,3-bis(ethenyl)-1H-indole;1-methyl-2-(2-pentylphenyl)benzene (PubChem CID 177144901) has the molecular formula C30H33N and a molecular weight of 407.60 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-1H-indole;1-methyl-2-(2-pentylphenyl)benzene.
| Compound Name | 2,3-bis(ethenyl)-1H-indole;1-methyl-2-(2-pentylphenyl)benzene |
|---|---|
| PubChem CID | 177144901 |
| Molecular Formula | C30H33N |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | 2,3-bis(ethenyl)-1H-indole;1-methyl-2-(2-pentylphenyl)benzene |
| SMILES | C=Cc1[nH]c2ccccc2c1C=C.CCCCCc1ccccc1-c1ccccc1C |
| InChI | InChI=1S/C18H22.C12H11N/c1-3-4-5-11-16-12-7-9-14-18(16)17-13-8-6-10-15(17)2;1-3-9-10-7-5-6-8-12(10)13-11(9)4-2/h6-10,12-14H,3-5,11H2,1-2H3;3-8,13H,1-2H2 |
| InChIKey | JQJDTJKILPVXKJ-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|