C54H85O3P-2 — CID 19065302
[2,3-di(nonyl)-4,5-bis(2-nonylphenyl)phenyl] phosphite (PubChem CID 19065302) has the molecular formula C54H85O3P-2 and a molecular weight of 813.24 g/mol. Its IUPAC name is [2,3-di(nonyl)-4,5-bis(2-nonylphenyl)phenyl] phosphite.
| Compound Name | [2,3-di(nonyl)-4,5-bis(2-nonylphenyl)phenyl] phosphite |
|---|---|
| PubChem CID | 19065302 |
| Molecular Formula | C54H85O3P-2 |
| Molecular Weight | 813.24 g/mol |
| Exact Mass | 812.62 |
| IUPAC Name | [2,3-di(nonyl)-4,5-bis(2-nonylphenyl)phenyl] phosphite |
| SMILES | CCCCCCCCCc1ccccc1-c1cc(OP([O-])[O-])c(CCCCCCCCC)c(CCCCCCCCC)c1-c1ccccc1CCCCCCCCC |
| InChI | InChI=1S/C54H85O3P/c1-5-9-13-17-21-25-29-37-46-39-33-35-41-48(46)52-45-53(57-58(55)56)50(43-31-27-23-19-15-11-7-3)51(44-32-28-24-20-16-12-8-4)54(52)49-42-36-34-40-47(49)38-30-26-22-18-14-10-6-2/h33-36,39-42,45H,5-32,37-38,43-44H2,1-4H3/q-2 |
| InChIKey | XEHZWIJSPVOKQG-UHFFFAOYSA-N |
| XLogP | 16.52 |
| TPSA | 55.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.24 |
| LogP ≤ 5 | 16.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|