C21H30 — CID 176927954
ethane;2-ethenyl-1-ethyl-1-propan-2-yl-3-[(Z)-prop-1-enyl]indene (PubChem CID 176927954) has the molecular formula C21H30 and a molecular weight of 282.47 g/mol. Its IUPAC name is ethane;2-ethenyl-1-ethyl-1-propan-2-yl-3-[(Z)-prop-1-enyl]indene.
| Compound Name | ethane;2-ethenyl-1-ethyl-1-propan-2-yl-3-[(Z)-prop-1-enyl]indene |
|---|---|
| PubChem CID | 176927954 |
| Molecular Formula | C21H30 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | ethane;2-ethenyl-1-ethyl-1-propan-2-yl-3-[(Z)-prop-1-enyl]indene |
| SMILES | C=CC1=C(/C=C\C)c2ccccc2C1(CC)C(C)C.CC |
| InChI | InChI=1S/C19H24.C2H6/c1-6-11-15-16-12-9-10-13-18(16)19(8-3,14(4)5)17(15)7-2;1-2/h6-7,9-14H,2,8H2,1,3-5H3;1-2H3/b11-6-; |
| InChIKey | XEJNNZXPUXJUES-AVHZNCSWSA-N |
| XLogP | 6.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |