About 3'-ethenyl-2'-[(Z)-prop-1-enyl]spiro[cyclopentane-1,1'-indene]
3'-ethenyl-2'-[(Z)-prop-1-enyl]spiro[cyclopentane-1,1'-indene] (PubChem CID 143984015) has the molecular formula C18H20
and a molecular weight of 236.36 g/mol. Its IUPAC name is 3'-ethenyl-2'-[(Z)-prop-1-enyl]spiro[cyclopentane-1,1'-indene].
Molecular Properties
| Compound Name | 3'-ethenyl-2'-[(Z)-prop-1-enyl]spiro[cyclopentane-1,1'-indene] |
| PubChem CID | 143984015 |
| Molecular Formula | C18H20 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 3'-ethenyl-2'-[(Z)-prop-1-enyl]spiro[cyclopentane-1,1'-indene] |
| SMILES | C=CC1=C(/C=C\C)C2(CCCC2)c2ccccc21 |
| InChI | InChI=1S/C18H20/c1-3-9-16-14(4-2)15-10-5-6-11-17(15)18(16)12-7-8-13-18/h3-6,9-11H,2,7-8,12-13H2,1H3/b9-3- |
| InChIKey | VWWPMUAVWHSEPJ-OQFOIZHKSA-N |
| XLogP | 5.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3'-ethenyl-2'-[(Z)-prop-1-enyl]spiro[cyclopentane-1,1'-indene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3'-ethenyl-2'-[(Z)-prop-1-enyl]spiro[cyclopentane-1,1'-indene]?
The IUPAC name of 3'-ethenyl-2'-[(Z)-prop-1-enyl]spiro[cyclopentane-1,1'-indene] (CID 143984015) is 3'-ethenyl-2'-[(Z)-prop-1-enyl]spiro[cyclopentane-1,1'-indene].
What is the SMILES notation for 3'-ethenyl-2'-[(Z)-prop-1-enyl]spiro[cyclopentane-1,1'-indene]?
The canonical SMILES for 3'-ethenyl-2'-[(Z)-prop-1-enyl]spiro[cyclopentane-1,1'-indene] is C=CC1=C(/C=C\C)C2(CCCC2)c2ccccc21.
What is the InChIKey of 3'-ethenyl-2'-[(Z)-prop-1-enyl]spiro[cyclopentane-1,1'-indene]?
The InChIKey is VWWPMUAVWHSEPJ-OQFOIZHKSA-N. The full InChI is InChI=1S/C18H20/c1-3-9-16-14(4-2)15-10-5-6-11-17(15)18(16)12-7-8-13-18/h3-6,9-11H,2,7-8,12-13H2,1H3/b9-3-.
What are the key properties of 3'-ethenyl-2'-[(Z)-prop-1-enyl]spiro[cyclopentane-1,1'-indene]?
3'-ethenyl-2'-[(Z)-prop-1-enyl]spiro[cyclopentane-1,1'-indene] has a molecular weight of 236.36 g/mol, XLogP of 5.03, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3'-ethenyl-2'-[(Z)-prop-1-enyl]spiro[cyclopentane-1,1'-indene] is sourced from PubChem (CID 143984015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).