About 2,3-bis(ethenyl)-1,1-diethylindene
2,3-bis(ethenyl)-1,1-diethylindene (PubChem CID 145133718) has the molecular formula C17H20
and a molecular weight of 224.35 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-1,1-diethylindene.
Molecular Properties
| Compound Name | 2,3-bis(ethenyl)-1,1-diethylindene |
| PubChem CID | 145133718 |
| Molecular Formula | C17H20 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 2,3-bis(ethenyl)-1,1-diethylindene |
| SMILES | C=CC1=C(C=C)C(CC)(CC)c2ccccc21 |
| InChI | InChI=1S/C17H20/c1-5-13-14-11-9-10-12-16(14)17(7-3,8-4)15(13)6-2/h5-6,9-12H,1-2,7-8H2,3-4H3 |
| InChIKey | GVKLWAFVJPJUQA-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,3-bis(ethenyl)-1,1-diethylindene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(ethenyl)-1,1-diethylindene?
The IUPAC name of 2,3-bis(ethenyl)-1,1-diethylindene (CID 145133718) is 2,3-bis(ethenyl)-1,1-diethylindene.
What is the SMILES notation for 2,3-bis(ethenyl)-1,1-diethylindene?
The canonical SMILES for 2,3-bis(ethenyl)-1,1-diethylindene is C=CC1=C(C=C)C(CC)(CC)c2ccccc21.
What is the InChIKey of 2,3-bis(ethenyl)-1,1-diethylindene?
The InChIKey is GVKLWAFVJPJUQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20/c1-5-13-14-11-9-10-12-16(14)17(7-3,8-4)15(13)6-2/h5-6,9-12H,1-2,7-8H2,3-4H3.
What are the key properties of 2,3-bis(ethenyl)-1,1-diethylindene?
2,3-bis(ethenyl)-1,1-diethylindene has a molecular weight of 224.35 g/mol, XLogP of 4.88, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(ethenyl)-1,1-diethylindene is sourced from PubChem (CID 145133718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).