About 9-ethyl-9-propylfluorene
9-ethyl-9-propylfluorene (PubChem CID 123584741) has the molecular formula C18H20
and a molecular weight of 236.36 g/mol. Its IUPAC name is 9-ethyl-9-propylfluorene.
Molecular Properties
| Compound Name | 9-ethyl-9-propylfluorene |
| PubChem CID | 123584741 |
| Molecular Formula | C18H20 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 9-ethyl-9-propylfluorene |
| SMILES | CCCC1(CC)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C18H20/c1-3-13-18(4-2)16-11-7-5-9-14(16)15-10-6-8-12-17(15)18/h5-12H,3-4,13H2,1-2H3 |
| InChIKey | CKFOKMUQSRHJOY-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 9-ethyl-9-propylfluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethyl-9-propylfluorene?
The IUPAC name of 9-ethyl-9-propylfluorene (CID 123584741) is 9-ethyl-9-propylfluorene.
What is the SMILES notation for 9-ethyl-9-propylfluorene?
The canonical SMILES for 9-ethyl-9-propylfluorene is CCCC1(CC)c2ccccc2-c2ccccc21.
What is the InChIKey of 9-ethyl-9-propylfluorene?
The InChIKey is CKFOKMUQSRHJOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20/c1-3-13-18(4-2)16-11-7-5-9-14(16)15-10-6-8-12-17(15)18/h5-12H,3-4,13H2,1-2H3.
What are the key properties of 9-ethyl-9-propylfluorene?
9-ethyl-9-propylfluorene has a molecular weight of 236.36 g/mol, XLogP of 5.16, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethyl-9-propylfluorene is sourced from PubChem (CID 123584741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).