C18H22 — CID 177033619
2-ethenyl-1-methyl-1-propan-2-yl-3-[(Z)-prop-1-enyl]indene (PubChem CID 177033619) has the molecular formula C18H22 and a molecular weight of 238.37 g/mol. Its IUPAC name is 2-ethenyl-1-methyl-1-propan-2-yl-3-[(Z)-prop-1-enyl]indene.
| Compound Name | 2-ethenyl-1-methyl-1-propan-2-yl-3-[(Z)-prop-1-enyl]indene |
|---|---|
| PubChem CID | 177033619 |
| Molecular Formula | C18H22 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 2-ethenyl-1-methyl-1-propan-2-yl-3-[(Z)-prop-1-enyl]indene |
| SMILES | C=CC1=C(/C=C\C)c2ccccc2C1(C)C(C)C |
| InChI | InChI=1S/C18H22/c1-6-10-14-15-11-8-9-12-17(15)18(5,13(3)4)16(14)7-2/h6-13H,2H2,1,3-5H3/b10-6- |
| InChIKey | UWZRZMYMAPQTQW-POHAHGRESA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |