About 2,3-bis(ethenyl)-2'-methyl-3'-prop-1-enylspiro[chromene-4,1'-indene]
2,3-bis(ethenyl)-2'-methyl-3'-prop-1-enylspiro[chromene-4,1'-indene] (PubChem CID 123379297) has the molecular formula C25H22O
and a molecular weight of 338.45 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-2'-methyl-3'-prop-1-enylspiro[chromene-4,1'-indene].
Molecular Properties
| Compound Name | 2,3-bis(ethenyl)-2'-methyl-3'-prop-1-enylspiro[chromene-4,1'-indene] |
| PubChem CID | 123379297 |
| Molecular Formula | C25H22O |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 2,3-bis(ethenyl)-2'-methyl-3'-prop-1-enylspiro[chromene-4,1'-indene] |
| SMILES | C=CC1=C(C=C)C2(C(C)=C(C=CC)c3ccccc32)c2ccccc2O1 |
| InChI | InChI=1S/C25H22O/c1-5-12-18-17(4)25(21-14-9-8-13-19(18)21)20(6-2)23(7-3)26-24-16-11-10-15-22(24)25/h5-16H,2-3H2,1,4H3 |
| InChIKey | ICLSNEMMIFATQL-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3-bis(ethenyl)-2'-methyl-3'-prop-1-enylspiro[chromene-4,1'-indene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(ethenyl)-2'-methyl-3'-prop-1-enylspiro[chromene-4,1'-indene]?
The IUPAC name of 2,3-bis(ethenyl)-2'-methyl-3'-prop-1-enylspiro[chromene-4,1'-indene] (CID 123379297) is 2,3-bis(ethenyl)-2'-methyl-3'-prop-1-enylspiro[chromene-4,1'-indene].
What is the SMILES notation for 2,3-bis(ethenyl)-2'-methyl-3'-prop-1-enylspiro[chromene-4,1'-indene]?
The canonical SMILES for 2,3-bis(ethenyl)-2'-methyl-3'-prop-1-enylspiro[chromene-4,1'-indene] is C=CC1=C(C=C)C2(C(C)=C(C=CC)c3ccccc32)c2ccccc2O1.
What is the InChIKey of 2,3-bis(ethenyl)-2'-methyl-3'-prop-1-enylspiro[chromene-4,1'-indene]?
The InChIKey is ICLSNEMMIFATQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22O/c1-5-12-18-17(4)25(21-14-9-8-13-19(18)21)20(6-2)23(7-3)26-24-16-11-10-15-22(24)25/h5-16H,2-3H2,1,4H3.
What are the key properties of 2,3-bis(ethenyl)-2'-methyl-3'-prop-1-enylspiro[chromene-4,1'-indene]?
2,3-bis(ethenyl)-2'-methyl-3'-prop-1-enylspiro[chromene-4,1'-indene] has a molecular weight of 338.45 g/mol, XLogP of 6.35, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(ethenyl)-2'-methyl-3'-prop-1-enylspiro[chromene-4,1'-indene] is sourced from PubChem (CID 123379297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).