C26H21BO2 — CID 142314021
[2'-ethenyl-3'-[(Z)-prop-1-enyl]spiro[fluorene-9,1'-indene]-1-yl]boronic acid (PubChem CID 142314021) has the molecular formula C26H21BO2 and a molecular weight of 376.26 g/mol. Its IUPAC name is [2'-ethenyl-3'-[(Z)-prop-1-enyl]spiro[fluorene-9,1'-indene]-1-yl]boronic acid.
| Compound Name | [2'-ethenyl-3'-[(Z)-prop-1-enyl]spiro[fluorene-9,1'-indene]-1-yl]boronic acid |
|---|---|
| PubChem CID | 142314021 |
| Molecular Formula | C26H21BO2 |
| Molecular Weight | 376.26 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | [2'-ethenyl-3'-[(Z)-prop-1-enyl]spiro[fluorene-9,1'-indene]-1-yl]boronic acid |
| SMILES | C=CC1=C(/C=C\C)c2ccccc2C12c1ccccc1-c1cccc(B(O)O)c12 |
| InChI | InChI=1S/C26H21BO2/c1-3-10-17-18-11-5-7-14-22(18)26(21(17)4-2)23-15-8-6-12-19(23)20-13-9-16-24(25(20)26)27(28)29/h3-16,28-29H,2H2,1H3/b10-3- |
| InChIKey | IULIUDKXWUZKOV-KMKOMSMNSA-N |
| XLogP | 4.21 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.26 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|