C27H24 — CID 142597844
2-[(1Z)-buta-1,3-dienyl]-2'-ethenyl-3-methyl-3'-[(Z)-prop-1-enyl]-1,1'-spirobi[indene] (PubChem CID 142597844) has the molecular formula C27H24 and a molecular weight of 348.49 g/mol. Its IUPAC name is 2-[(1Z)-buta-1,3-dienyl]-2'-ethenyl-3-methyl-3'-[(Z)-prop-1-enyl]-1,1'-spirobi[indene].
| Compound Name | 2-[(1Z)-buta-1,3-dienyl]-2'-ethenyl-3-methyl-3'-[(Z)-prop-1-enyl]-1,1'-spirobi[indene] |
|---|---|
| PubChem CID | 142597844 |
| Molecular Formula | C27H24 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | 2-[(1Z)-buta-1,3-dienyl]-2'-ethenyl-3-methyl-3'-[(Z)-prop-1-enyl]-1,1'-spirobi[indene] |
| SMILES | C=C/C=C\C1=C(C)c2ccccc2C12C(C=C)=C(/C=C\C)c1ccccc12 |
| InChI | InChI=1S/C27H24/c1-5-8-16-24-19(4)20-14-9-11-17-25(20)27(24)23(7-3)21(13-6-2)22-15-10-12-18-26(22)27/h5-18H,1,3H2,2,4H3/b13-6-,16-8- |
| InChIKey | IIGKKPPITBRNKR-JAHOSLNCSA-N |
| XLogP | 7.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|