About 2-[(1Z)-buta-1,3-dienyl]-2'-ethenyl-3-methyl-3'-[(Z)-prop-1-enyl]-1,1'-spirobi[indene]
2-[(1Z)-buta-1,3-dienyl]-2'-ethenyl-3-methyl-3'-[(Z)-prop-1-enyl]-1,1'-spirobi[indene] (PubChem CID 142597844) has the molecular formula C27H24
and a molecular weight of 348.49 g/mol. Its IUPAC name is 2-[(1Z)-buta-1,3-dienyl]-2'-ethenyl-3-methyl-3'-[(Z)-prop-1-enyl]-1,1'-spirobi[indene].
Molecular Properties
| Compound Name | 2-[(1Z)-buta-1,3-dienyl]-2'-ethenyl-3-methyl-3'-[(Z)-prop-1-enyl]-1,1'-spirobi[indene] |
| PubChem CID | 142597844 |
| Molecular Formula | C27H24 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | 2-[(1Z)-buta-1,3-dienyl]-2'-ethenyl-3-methyl-3'-[(Z)-prop-1-enyl]-1,1'-spirobi[indene] |
| SMILES | C=C/C=C\C1=C(C)c2ccccc2C12C(C=C)=C(/C=C\C)c1ccccc12 |
| InChI | InChI=1S/C27H24/c1-5-8-16-24-19(4)20-14-9-11-17-25(20)27(24)23(7-3)21(13-6-2)22-15-10-12-18-26(22)27/h5-18H,1,3H2,2,4H3/b13-6-,16-8- |
| InChIKey | IIGKKPPITBRNKR-JAHOSLNCSA-N |
| XLogP | 7.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1Z)-buta-1,3-dienyl]-2'-ethenyl-3-methyl-3'-[(Z)-prop-1-enyl]-1,1'-spirobi[indene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1Z)-buta-1,3-dienyl]-2'-ethenyl-3-methyl-3'-[(Z)-prop-1-enyl]-1,1'-spirobi[indene]?
The IUPAC name of 2-[(1Z)-buta-1,3-dienyl]-2'-ethenyl-3-methyl-3'-[(Z)-prop-1-enyl]-1,1'-spirobi[indene] (CID 142597844) is 2-[(1Z)-buta-1,3-dienyl]-2'-ethenyl-3-methyl-3'-[(Z)-prop-1-enyl]-1,1'-spirobi[indene].
What is the SMILES notation for 2-[(1Z)-buta-1,3-dienyl]-2'-ethenyl-3-methyl-3'-[(Z)-prop-1-enyl]-1,1'-spirobi[indene]?
The canonical SMILES for 2-[(1Z)-buta-1,3-dienyl]-2'-ethenyl-3-methyl-3'-[(Z)-prop-1-enyl]-1,1'-spirobi[indene] is C=C/C=C\C1=C(C)c2ccccc2C12C(C=C)=C(/C=C\C)c1ccccc12.
What is the InChIKey of 2-[(1Z)-buta-1,3-dienyl]-2'-ethenyl-3-methyl-3'-[(Z)-prop-1-enyl]-1,1'-spirobi[indene]?
The InChIKey is IIGKKPPITBRNKR-JAHOSLNCSA-N. The full InChI is InChI=1S/C27H24/c1-5-8-16-24-19(4)20-14-9-11-17-25(20)27(24)23(7-3)21(13-6-2)22-15-10-12-18-26(22)27/h5-18H,1,3H2,2,4H3/b13-6-,16-8-.
What are the key properties of 2-[(1Z)-buta-1,3-dienyl]-2'-ethenyl-3-methyl-3'-[(Z)-prop-1-enyl]-1,1'-spirobi[indene]?
2-[(1Z)-buta-1,3-dienyl]-2'-ethenyl-3-methyl-3'-[(Z)-prop-1-enyl]-1,1'-spirobi[indene] has a molecular weight of 348.49 g/mol, XLogP of 7.03, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1Z)-buta-1,3-dienyl]-2'-ethenyl-3-methyl-3'-[(Z)-prop-1-enyl]-1,1'-spirobi[indene] is sourced from PubChem (CID 142597844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).