C25H22N2 — CID 163887285
2'-methyl-1'-[(Z)-prop-1-enyl]spiro[fluorene-9,3'-indene]-2,5'-diamine (PubChem CID 163887285) has the molecular formula C25H22N2 and a molecular weight of 350.47 g/mol. Its IUPAC name is 2'-methyl-1'-[(Z)-prop-1-enyl]spiro[fluorene-9,3'-indene]-2,5'-diamine.
| Compound Name | 2'-methyl-1'-[(Z)-prop-1-enyl]spiro[fluorene-9,3'-indene]-2,5'-diamine |
|---|---|
| PubChem CID | 163887285 |
| Molecular Formula | C25H22N2 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 2'-methyl-1'-[(Z)-prop-1-enyl]spiro[fluorene-9,3'-indene]-2,5'-diamine |
| SMILES | C/C=C\C1=C(C)C2(c3cc(N)ccc31)c1ccccc1-c1ccc(N)cc12 |
| InChI | InChI=1S/C25H22N2/c1-3-6-18-15(2)25(23-13-16(26)9-11-20(18)23)22-8-5-4-7-19(22)21-12-10-17(27)14-24(21)25/h3-14H,26-27H2,1-2H3/b6-3- |
| InChIKey | PYMDZIRSMNUVGO-UTCJRWHESA-N |
| XLogP | 5.53 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|