C23H19Br — CID 123721476
6-bromo-3,3'-bis(ethenyl)-2,2'-dimethyl-1,1'-spirobi[indene] (PubChem CID 123721476) has the molecular formula C23H19Br and a molecular weight of 375.31 g/mol. Its IUPAC name is 6-bromo-3,3'-bis(ethenyl)-2,2'-dimethyl-1,1'-spirobi[indene].
| Compound Name | 6-bromo-3,3'-bis(ethenyl)-2,2'-dimethyl-1,1'-spirobi[indene] |
|---|---|
| PubChem CID | 123721476 |
| Molecular Formula | C23H19Br |
| Molecular Weight | 375.31 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | 6-bromo-3,3'-bis(ethenyl)-2,2'-dimethyl-1,1'-spirobi[indene] |
| SMILES | C=CC1=C(C)C2(C(C)=C(C=C)c3ccc(Br)cc32)c2ccccc21 |
| InChI | InChI=1S/C23H19Br/c1-5-17-14(3)23(21-10-8-7-9-19(17)21)15(4)18(6-2)20-12-11-16(24)13-22(20)23/h5-13H,1-2H2,3-4H3 |
| InChIKey | YYYFGNWTGZDBHB-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.31 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |