C33H27BrO — CID 154999840
6-bromo-1-[4-(4-ethenylphenoxy)phenyl]-2-methyl-1-phenyl-3-[(Z)-prop-1-enyl]indene (PubChem CID 154999840) has the molecular formula C33H27BrO and a molecular weight of 519.48 g/mol. Its IUPAC name is 6-bromo-1-[4-(4-ethenylphenoxy)phenyl]-2-methyl-1-phenyl-3-[(Z)-prop-1-enyl]indene.
| Compound Name | 6-bromo-1-[4-(4-ethenylphenoxy)phenyl]-2-methyl-1-phenyl-3-[(Z)-prop-1-enyl]indene |
|---|---|
| PubChem CID | 154999840 |
| Molecular Formula | C33H27BrO |
| Molecular Weight | 519.48 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | 6-bromo-1-[4-(4-ethenylphenoxy)phenyl]-2-methyl-1-phenyl-3-[(Z)-prop-1-enyl]indene |
| SMILES | C=Cc1ccc(Oc2ccc(C3(c4ccccc4)C(C)=C(/C=C\C)c4ccc(Br)cc43)cc2)cc1 |
| InChI | InChI=1S/C33H27BrO/c1-4-9-30-23(3)33(25-10-7-6-8-11-25,32-22-27(34)16-21-31(30)32)26-14-19-29(20-15-26)35-28-17-12-24(5-2)13-18-28/h4-22H,2H2,1,3H3/b9-4- |
| InChIKey | LCEANCYTPROGHC-WTKPLQERSA-N |
| XLogP | 9.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.48 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |