C25H17Br — CID 177098978
2-bromo-9,9-bis(2,3,4,5,6-pentadeuteriophenyl)fluorene (PubChem CID 177098978) has the molecular formula C25H17Br and a molecular weight of 407.38 g/mol. Its IUPAC name is 2-bromo-9,9-bis(2,3,4,5,6-pentadeuteriophenyl)fluorene.
| Compound Name | 2-bromo-9,9-bis(2,3,4,5,6-pentadeuteriophenyl)fluorene |
|---|---|
| PubChem CID | 177098978 |
| Molecular Formula | C25H17Br |
| Molecular Weight | 407.38 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 2-bromo-9,9-bis(2,3,4,5,6-pentadeuteriophenyl)fluorene |
| SMILES | [2H]c1c([2H])c([2H])c(C2(c3c([2H])c([2H])c([2H])c([2H])c3[2H])c3ccccc3-c3ccc(Br)cc32)c([2H])c1[2H] |
| InChI | InChI=1S/C25H17Br/c26-20-15-16-22-21-13-7-8-14-23(21)25(24(22)17-20,18-9-3-1-4-10-18)19-11-5-2-6-12-19/h1-17H/i1D,2D,3D,4D,5D,6D,9D,10D,11D,12D |
| InChIKey | WNXNWOBGPRKOJF-CRDOFXDFSA-N |
| XLogP | 6.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.38 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |