C31H19BrO — CID 156687579
4-[3-bromo-9-(2,3,4,5,6-pentadeuteriophenyl)fluoren-9-yl]dibenzofuran (PubChem CID 156687579) has the molecular formula C31H19BrO and a molecular weight of 492.43 g/mol. Its IUPAC name is 4-[3-bromo-9-(2,3,4,5,6-pentadeuteriophenyl)fluoren-9-yl]dibenzofuran.
| Compound Name | 4-[3-bromo-9-(2,3,4,5,6-pentadeuteriophenyl)fluoren-9-yl]dibenzofuran |
|---|---|
| PubChem CID | 156687579 |
| Molecular Formula | C31H19BrO |
| Molecular Weight | 492.43 g/mol |
| Exact Mass | 491.09 |
| IUPAC Name | 4-[3-bromo-9-(2,3,4,5,6-pentadeuteriophenyl)fluoren-9-yl]dibenzofuran |
| SMILES | [2H]c1c([2H])c([2H])c(C2(c3cccc4c3oc3ccccc34)c3ccccc3-c3cc(Br)ccc32)c([2H])c1[2H] |
| InChI | InChI=1S/C31H19BrO/c32-21-17-18-27-25(19-21)22-11-4-6-14-26(22)31(27,20-9-2-1-3-10-20)28-15-8-13-24-23-12-5-7-16-29(23)33-30(24)28/h1-19H/i1D,2D,3D,9D,10D |
| InChIKey | VIUQCIKYKOFCBH-MYWHSQMISA-N |
| XLogP | 8.71 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.43 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |